1-Ethyl-3-azetidinol - CAS 35995-21-2
Catalog: |
BB022826 |
Product Name: |
1-Ethyl-3-azetidinol |
CAS: |
35995-21-2 |
Synonyms: |
1-ethyl-3-azetidinol; 1-ethylazetidin-3-ol |
IUPAC Name: | 1-ethylazetidin-3-ol |
Description: | 1-Ethyl-3-azetidinol (CAS# 35995-21-2) is a useful research chemical. |
Molecular Weight: | 101.15 |
Molecular Formula: | C5H11NO |
Canonical SMILES: | CCN1CC(C1)O |
InChI: | InChI=1S/C5H11NO/c1-2-6-3-5(7)4-6/h5,7H,2-4H2,1H3 |
InChI Key: | ZMXWVFGREWGXIE-UHFFFAOYSA-N |
MDL: | MFCD17016029 |
LogP: | 0.42270 |
Publication Number | Title | Priority Date |
CN-109311889-A | Activin receptor sample kinase inhibitor | 20160415 |
AU-2015221956-B2 | N2-phenyl-pyrido[3,4-d]pyrimidine-2,8-diamine derivatives and their use as Mps1 inhibitors | 20140228 |
CA-2939058-A1 | N2-phenyl-pyrido[3,4-d]pyrimidine-2,8-diamine derivatives and their use as mps1 inhibitors | 20140228 |
EP-3110816-A1 | N2-phenyl-pyrido[3,4-d]pyrimidine-2,8-diamine derivatives and their use as mps1 inhibitors | 20140228 |
US-10399974-B2 | N2-phenyl-pyrido[3,4-D]pyrimidine-2, 8-diamine derivatives and their use as Mps1 inhibitors | 20140228 |
Complexity: | 59.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 101.084063974 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 101.084063974 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS