1-Cyclohexene-1-carbonyl Chloride - CAS 36278-22-5
Catalog: |
BB022928 |
Product Name: |
1-Cyclohexene-1-carbonyl Chloride |
CAS: |
36278-22-5 |
Synonyms: |
1-cyclohexenecarbonyl chloride; cyclohexene-1-carbonyl chloride |
IUPAC Name: | cyclohexene-1-carbonyl chloride |
Description: | 1-Cyclohexene-1-carbonyl Chloride (CAS# 36278-22-5) is a reagent used in the synthesis of anti-inflammatory broad-spectrum chemokine inhibitors. |
Molecular Weight: | 144.60 |
Molecular Formula: | C7H9ClO |
Canonical SMILES: | C1CCC(=CC1)C(=O)Cl |
InChI: | InChI=1S/C7H9ClO/c8-7(9)6-4-2-1-3-5-6/h4H,1-3,5H2 |
InChI Key: | OXARPLABDJXAQJ-UHFFFAOYSA-N |
Boiling Point: | 203.9 °C at 760 mmHg |
Density: | 1.167 g/cm3 |
MDL: | MFCD00037154 |
LogP: | 2.25220 |
Publication Number | Title | Priority Date |
WO-2021068816-A1 | Alkene-containing amide compound and use thereof | 20191008 |
WO-2021068820-A1 | Alkene-containing carboxylate compound and use thereof | 20191008 |
JP-2021050143-A | Epoxy compound manufacturing method | 20190920 |
WO-2021054224-A1 | Epoxy compound production method | 20190920 |
JP-2020143260-A | Method for producing polysaccharide derivative and method for producing lignin derivative | 20190308 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 144.0341926 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 144.0341926 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS