1-(Chloromethyl)-4-methylcyclohexane - CAS 1073-68-3
Catalog: |
BB002066 |
Product Name: |
1-(Chloromethyl)-4-methylcyclohexane |
CAS: |
1073-68-3 |
Synonyms: |
1-(chloromethyl)-4-methylcyclohexane; 1-(chloromethyl)-4-methylcyclohexane |
IUPAC Name: | 1-(chloromethyl)-4-methylcyclohexane |
Description: | 1-(Chloromethyl)-4-methylcyclohexane (CAS# 1073-68-3 ) is a useful research chemical. |
Molecular Weight: | 146.66 |
Molecular Formula: | C8H15Cl |
Canonical SMILES: | CC1CCC(CC1)CCl |
InChI: | InChI=1S/C8H15Cl/c1-7-2-4-8(6-9)5-3-7/h7-8H,2-6H2,1H3 |
InChI Key: | UURNLXIWBYIBFP-UHFFFAOYSA-N |
LogP: | 3.05150 |
GHS Hazard Statement: | H227 (100%): Combustible liquid [Warning Flammable liquids] |
Precautionary Statement: | P210, P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P370+P378, P403+P233, P403+P235, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
ES-2779225-T3 | Substituted merylformyl reagents and procedure for their use to modify physicochemical and / or pharmacokinetic properties of compounds | 20110408 |
CN-101565363-B | Method for preparing 4-[2'-(trans-4'-alkylcyclohexyl)ethyl] cyclohexanone liquid crystal intermediate compound | 20090528 |
US-2010197516-A1 | Detechip: molecular color and fluorescent sensory arrays for small molecules | 20080715 |
US-2010184986-A1 | Sulfonamide-based organocatalysts and method for their use | 20070917 |
EP-2206695-A1 | Tetra- or penta-cyclic liquid crystalline compound having lateral fluorine, liquid crystal composition, and liquid crystal display element | 20070906 |
Complexity: | 72.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 146.0862282 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 146.0862282 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS