1-Chloro-2,5-difluoro-4-iodobenzene - CAS 1097871-23-2
Catalog: |
BB002541 |
Product Name: |
1-Chloro-2,5-difluoro-4-iodobenzene |
CAS: |
1097871-23-2 |
Synonyms: |
1-chloro-2,5-difluoro-4-iodobenzene; 1-chloro-2,5-difluoro-4-iodobenzene |
IUPAC Name: | 1-chloro-2,5-difluoro-4-iodobenzene |
Description: | 1-Chloro-2,5-difluoro-4-iodobenzene (CAS# 1097871-23-2) is a useful research chemical. |
Molecular Weight: | 274.43 |
Molecular Formula: | C6H2ClF2I |
Canonical SMILES: | C1=C(C(=CC(=C1Cl)F)I)F |
InChI: | InChI=1S/C6H2ClF2I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
InChI Key: | JPIRZHIXWRVIAX-UHFFFAOYSA-N |
Storage: | Inert atmosphere, 2-8 ℃ |
LogP: | 3.22280 |
Publication Number | Title | Priority Date |
AU-2018332887-A1 | Bisamide sarcomere activating compounds and uses thereof | 20170913 |
CA-3075669-A1 | Bisamide sarcomere activating compounds and uses thereof | 20170913 |
KR-20200054237-A | Bisamide muscle fibrillar node activating compound and use thereof | 20170913 |
TW-201920096-A | Diammine sarcomeric activation compound and use thereof | 20170913 |
US-2019077793-A1 | Bisamide sarcomere activating compounds and uses thereof | 20170913 |
Complexity: | 122 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 273.88578 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 273.88578 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS