1-Cbz-3-bromo-4-oxopiperidine - CAS 174184-13-5
Catalog: |
BB012990 |
Product Name: |
1-Cbz-3-bromo-4-oxopiperidine |
CAS: |
174184-13-5 |
Synonyms: |
3-bromo-4-oxo-1-piperidinecarboxylic acid (phenylmethyl) ester; benzyl 3-bromo-4-oxopiperidine-1-carboxylate |
IUPAC Name: | benzyl 3-bromo-4-oxopiperidine-1-carboxylate |
Description: | 1-Cbz-3-bromo-4-oxopiperidine (CAS# 174184-13-5) is a useful research chemical compound. |
Molecular Weight: | 312.16 |
Molecular Formula: | C13H14BrNO3 |
Canonical SMILES: | C1CN(CC(C1=O)Br)C(=O)OCC2=CC=CC=C2 |
InChI: | InChI=1S/C13H14BrNO3/c14-11-8-15(7-6-12(11)16)13(17)18-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
InChI Key: | HIJNDCHNTWYMKT-UHFFFAOYSA-N |
MDL: | MFCD09953304 |
LogP: | 2.29940 |
GHS Hazard Statement: | H302+H312+H332 (100%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oral; acute toxicity, dermal; acute toxicity, inhalation] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2018240418-A1 | Chemical compounds as antibiotics | 20170321 |
CA-3056815-A1 | Chemical compounds as antibiotics | 20170321 |
CN-110914238-A | Compounds as antibiotics | 20170321 |
EP-3601224-A1 | Chemical compounds as antibiotics | 20170321 |
US-2020155509-A1 | Chemical compounds as antibiotics | 20170321 |
Complexity: | 315 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 311.01571 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 311.01571 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 46.6 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperidones
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS