1-Bromo-4-(trans-4-pentylcyclohexyl)benzene - CAS 79832-89-6
Catalog: |
BB036414 |
Product Name: |
1-Bromo-4-(trans-4-pentylcyclohexyl)benzene |
CAS: |
79832-89-6 |
Synonyms: |
1-bromo-4-(4-pentylcyclohexyl)benzene; 1-bromo-4-(4-pentylcyclohexyl)benzene |
IUPAC Name: | 1-bromo-4-(4-pentylcyclohexyl)benzene |
Description: | 1-Bromo-4-(trans-4-pentylcyclohexyl)benzene (CAS# 79832-89-6) is a useful research chemical. |
Molecular Weight: | 309.28 |
Molecular Formula: | C17H25Br |
Canonical SMILES: | CCCCCC1CCC(CC1)C2=CC=C(C=C2)Br |
InChI: | InChI=1S/C17H25Br/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h10-15H,2-9H2,1H3 |
InChI Key: | QUWHOIKFJBTGHZ-UHFFFAOYSA-N |
Boiling Point: | 363 °C at 760 mmHg |
Density: | 1.129 g/cm3 |
MDL: | MFCD00577359 |
LogP: | 6.30320 |
Publication Number | Title | Priority Date |
CN-112779026-A | Alignment agent, diamine compound, alignment film, and liquid crystal display module | 20191105 |
TW-I717889-B | Alignment agent, diamine compound, alignment film and liquid crystal display device | 20191105 |
CN-110546560-A | Liquid crystal aligning agent, liquid crystal alignment film, and liquid crystal display element | 20170227 |
KR-20190124743-A | Liquid crystal aligning agent, liquid crystal aligning film, and liquid crystal display element | 20170227 |
TW-201900855-A | Liquid crystal alignment agent, liquid crystal alignment film, and liquid crystal display element | 20170227 |
Complexity: | 210 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 308.11396 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 308.11396 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 7.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS