1-Bromo-4-fluoro-2-methyl-5-nitrobenzene - CAS 170098-98-3
Catalog: |
BB012609 |
Product Name: |
1-Bromo-4-fluoro-2-methyl-5-nitrobenzene |
CAS: |
170098-98-3 |
Synonyms: |
1-bromo-4-fluoro-2-methyl-5-nitrobenzene; 1-bromo-4-fluoro-2-methyl-5-nitrobenzene |
IUPAC Name: | 1-bromo-4-fluoro-2-methyl-5-nitrobenzene |
Description: | 1-Bromo-4-fluoro-2-methyl-5-nitrobenzene (CAS# 170098-98-3) is a useful research chemical. |
Molecular Weight: | 234.02 |
Molecular Formula: | C7H5BrFNO2 |
Canonical SMILES: | CC1=CC(=C(C=C1Br)[N+](=O)[O-])F |
InChI: | InChI=1S/C7H5BrFNO2/c1-4-2-6(9)7(10(11)12)3-5(4)8/h2-3H,1H3 |
InChI Key: | VMXDJIHJOUZBAW-UHFFFAOYSA-N |
LogP: | 3.32800 |
Publication Number | Title | Priority Date |
WO-2021084765-A1 | 4-aminobut-2-enamide derivatives and salts thereof | 20191031 |
WO-2021085653-A1 | 4-aminobut-2-enamide derivatives and salts thereof | 20191031 |
WO-2020227484-A1 | Substituted benzimidazolone compounds | 20190509 |
WO-2020172932-A1 | Aniline wdr5 protein-protein interaction inhibitor, preparation method therefor and use thereof | 20190226 |
WO-2020104822-A1 | Compounds | 20181123 |
Complexity: | 185 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 232.94877 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 232.94877 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 45.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS