1-Bromo-4-(chloromethyl)naphthalene - CAS 101828-11-9
Catalog: |
BB000665 |
Product Name: |
1-Bromo-4-(chloromethyl)naphthalene |
CAS: |
101828-11-9 |
Synonyms: |
1-bromo-4-(chloromethyl)naphthalene; 1-bromo-4-(chloromethyl)naphthalene |
IUPAC Name: | 1-bromo-4-(chloromethyl)naphthalene |
Description: | 1-Bromo-4-(chloromethyl)naphthalene (CAS# 101828-11-9 ) is a useful research chemical. |
Molecular Weight: | 255.54 |
Molecular Formula: | C11H8BrCl |
Canonical SMILES: | C1=CC=C2C(=C1)C(=CC=C2Br)CCl |
InChI: | InChI=1S/C11H8BrCl/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11/h1-6H,7H2 |
InChI Key: | AVHPSHRBXHDYIR-UHFFFAOYSA-N |
LogP: | 4.34110 |
Publication Number | Title | Priority Date |
WO-2020067594-A1 | Heterocyclic compound and organic light emitting diode comprising same | 20180928 |
JP-2009221169-A | 10-hydroxy-10-naphthylmethylanthracen-9 (10H) -one compound and its use as a photo radical polymerization initiator. | 20080318 |
JP-5299838-B2 | 10-hydroxy-10-naphthylmethylanthracen-9 (10H) -one compound and its use as a photo radical polymerization initiator. | 20080318 |
CN-1035771-A | The preparation method of amine derivative and the antifungal that contains amine derivative | 19870319 |
CN-1051702-C | Preparing process of amine derivative and fungusicide containing amine derivative | 19870319 |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 253.94979 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 253.94979 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS