1-Bromo-3-chloro-5-fluorobenzene - CAS 33863-76-2
Catalog: |
BB021870 |
Product Name: |
1-Bromo-3-chloro-5-fluorobenzene |
CAS: |
33863-76-2 |
Synonyms: |
1-bromo-3-chloro-5-fluorobenzene; 1-bromo-3-chloro-5-fluorobenzene |
IUPAC Name: | 1-bromo-3-chloro-5-fluorobenzene |
Description: | 1-Bromo-3-chloro-5-fluorobenzene (CAS# 33863-76-2) is a useful research chemical. |
Molecular Weight: | 209.44 |
Molecular Formula: | C6H3BrClF |
Canonical SMILES: | C1=C(C=C(C=C1Cl)Br)F |
InChI: | InChI=1S/C6H3BrClF/c7-4-1-5(8)3-6(9)2-4/h1-3H |
InChI Key: | GGMDFPMASIXEIR-UHFFFAOYSA-N |
Boiling Point: | 188.6 °C at 760 mmHg |
Purity: | 96 % |
Density: | 1.72 g/cm3 |
Appearance: | White to light yellow liquid |
MDL: | MFCD00070747 |
LogP: | 3.24160 |
GHS Hazard Statement: | H302 (82.61%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111978329-A | Compound, hole transport material, organic electroluminescent device and display device | 20200909 |
WO-2021204258-A1 | Azabicyclo compound as hepatitis b surface antigen inhibitor | 20200409 |
CN-113348171-A | Compound and organic light-emitting element comprising same | 20191129 |
CN-113348172-A | Compound and organic light emitting device including the same | 20191129 |
KR-20210067843-A | Compound and organic light emitting device comprising same | 20191129 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.90907 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.90907 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS