1-Bromo-2-isopropylbenzene - CAS 7073-94-1
Catalog: |
BB034230 |
Product Name: |
1-Bromo-2-isopropylbenzene |
CAS: |
7073-94-1 |
Synonyms: |
1-bromo-2-propan-2-ylbenzene; 1-bromo-2-propan-2-ylbenzene |
IUPAC Name: | 1-bromo-2-propan-2-ylbenzene |
Description: | 1-Bromo-2-isopropylbenzene (CAS# 7073-94-1) is a useful research chemical. |
Molecular Weight: | 199.09 |
Molecular Formula: | C9H11Br |
Canonical SMILES: | CC(C)C1=CC=CC=C1Br |
InChI: | InChI=1S/C9H11Br/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,1-2H3 |
InChI Key: | LECYCYNAEJDSIL-UHFFFAOYSA-N |
Boiling Point: | 90 °C |
Density: | 1.3 g/cm3 |
MDL: | MFCD00051567 |
LogP: | 3.57250 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P391, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113336665-A | Preparation method of bromobenzene para-aminated compound mediated by high-valence iodine reagent | 20210525 |
CN-113024477-A | Triazine compound and preparation method thereof | 20210312 |
CN-111848668-A | Pyridinylamino IVB group binuclear metal complex and preparation and application thereof | 20200805 |
WO-2021208963-A1 | Bcl-2 inhibitor | 20200415 |
CN-111205317-A | Novel [ ONN ] tridentate fourth subgroup metal complex and preparation method and application thereof | 20200219 |
Complexity: | 98.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 198.00441 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 198.00441 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS