1-Bromo-2-difluoromethylbenzene - CAS 845866-82-2
Catalog: |
BB037251 |
Product Name: |
1-Bromo-2-difluoromethylbenzene |
CAS: |
845866-82-2 |
Synonyms: |
1-bromo-2-(difluoromethyl)benzene |
IUPAC Name: | 1-bromo-2-(difluoromethyl)benzene |
Description: | 1-Bromo-2-difluoromethylbenzene (CAS# 845866-82-2) is a useful research chemical. |
Molecular Weight: | 207.02 |
Molecular Formula: | C7H5BrF2 |
Canonical SMILES: | C1=CC=C(C(=C1)C(F)F)Br |
InChI: | InChI=1S/C7H5BrF2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,7H |
InChI Key: | RMYPQIOCZSWSDG-UHFFFAOYSA-N |
MDL: | MFCD06657962 |
LogP: | 3.38670 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021041671-A1 | Kras g12d inhibitors | 20190829 |
WO-2020084492-A1 | Inhibitors of human immunodeficiency virus replication | 20181024 |
TW-202031261-A | Inhibitors of human immunodeficiency virus replication | 20181024 |
US-2020360384-A1 | Inhibitors of human immunodeficiency virus replication | 20181024 |
CN-113195475-A | Inhibitors of human immunodeficiency virus replication | 20181024 |
Complexity: | 106 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.95427 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.95427 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS