1-Boc-4-oxo-1-azaspiro[5.5]undecane - CAS 778647-35-1
Catalog: |
BB036060 |
Product Name: |
1-Boc-4-oxo-1-azaspiro[5.5]undecane |
CAS: |
778647-35-1 |
Synonyms: |
4-oxo-1-azaspiro[5.5]undecane-1-carboxylic acid tert-butyl ester; tert-butyl 4-oxo-1-azaspiro[5.5]undecane-1-carboxylate |
IUPAC Name: | tert-butyl 4-oxo-1-azaspiro[5.5]undecane-1-carboxylate |
Description: | 1-Boc-4-oxo-1-azaspiro[5.5]undecane (CAS# 778647-35-1) is a useful research chemical. |
Molecular Weight: | 267.36 |
Molecular Formula: | C15H25NO3 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC(=O)CC12CCCCC2 |
InChI: | InChI=1S/C15H25NO3/c1-14(2,3)19-13(18)16-10-7-12(17)11-15(16)8-5-4-6-9-15/h4-11H2,1-3H3 |
InChI Key: | RSTPQCYGFFSEEV-UHFFFAOYSA-N |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-1615898-A1 | 2-aminopyrimidine derivatives and their medical use | 20030411 |
EP-1615898-B1 | 2-Aminopyrimidine derivatives and their medical use | 20030411 |
JP-2006522768-A | Aminopyrimidine derivatives and their medical use | 20030411 |
JP-4619356-B2 | Aminopyrimidine derivatives and their medical use | 20030411 |
US-2007043048-A1 | 2-Aminopyrimidine derivatives and their medical use | 20030411 |
Complexity: | 364 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 267.18344366 |
Formal Charge: | 0 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.18344366 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 46.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS