1-Boc-4-fluoro-4-formylpiperidine - CAS 614731-09-8
Catalog: |
BB031127 |
Product Name: |
1-Boc-4-fluoro-4-formylpiperidine |
CAS: |
614731-09-8 |
Synonyms: |
4-fluoro-4-formyl-1-piperidinecarboxylic acid tert-butyl ester; tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate |
IUPAC Name: | tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate |
Description: | 1-Boc-4-fluoro-4-formylpiperidine (CAS# 614731-09-8 ) is a useful research chemical. |
Molecular Weight: | 231.26 |
Molecular Formula: | C11H18FNO3 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC(CC1)(C=O)F |
InChI: | InChI=1S/C11H18FNO3/c1-10(2,3)16-9(15)13-6-4-11(12,8-14)5-7-13/h8H,4-7H2,1-3H3 |
InChI Key: | GRSPYCFNEDACGF-UHFFFAOYSA-N |
Boiling Point: | 289.569 °C at 760 mmHg |
Density: | 1.129 g/cm3 |
LogP: | 1.86240 |
Publication Number | Title | Priority Date |
WO-2021055756-A1 | Spirocyclic androgen receptor protein degraders | 20190919 |
WO-2020100959-A1 | 1,3,4-oxadiazolone compound and medicine | 20181115 |
CN-113302184-A | 1,3, 4-oxadiazolinone compounds and drugs | 20181115 |
EP-3882239-A1 | 1,3,4-oxadiazolone compound and medicine | 20181115 |
JP-WO2020100959-A1 | 1,3,4-oxadiazolone compounds and pharmaceuticals | 20181115 |
Complexity: | 277 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.1270716 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.1270716 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 46.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS