1-Boc-4-(4-methylpiperazine-1-carbonyl)piperidine - CAS 205059-41-2
Catalog: |
BB016020 |
Product Name: |
1-Boc-4-(4-methylpiperazine-1-carbonyl)piperidine |
CAS: |
205059-41-2 |
Synonyms: |
4-[(4-methyl-1-piperazinyl)-oxomethyl]-1-piperidinecarboxylic acid tert-butyl ester; tert-butyl 4-(4-methylpiperazine-1-carbonyl)piperidine-1-carboxylate |
IUPAC Name: | tert-butyl 4-(4-methylpiperazine-1-carbonyl)piperidine-1-carboxylate |
Description: | 1-Boc-4-(4-methylpiperazine-1-carbonyl)piperidine (CAS# 205059-41-2 ) is a useful research chemical. |
Molecular Weight: | 311.42 |
Molecular Formula: | C16H29N3O3 |
Canonical SMILES: | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)N2CCN(CC2)C |
InChI: | InChI=1S/C16H29N3O3/c1-16(2,3)22-15(21)19-7-5-13(6-8-19)14(20)18-11-9-17(4)10-12-18/h13H,5-12H2,1-4H3 |
InChI Key: | NJCYAEJCGFMXPK-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
US-2014086936-A1 | Matriptase inhibitors and uses thereof against orthomyxoviridae infections | 20110602 |
EP-2401283-B1 | 6-phenyl-2-[((piperidin-4-ylmethyl)-piperazin-1yl) or piperazin 1-ylmethyl)-piperidin-1-yl)]-imidazo[2,1-b][1,3,4]thiadiazole derivatives and their use | 20090225 |
US-2011306619-A1 | 6-phenyl-2-[((piperidin-4-ylmethyl)-piperazin-1yl) or piperazin 1-ylmethyl)-piperidin-1-yl)]-imidazo[2,1-b][1,3,4]thiadiazole derivatives and their use | 20090225 |
US-8653082-B2 | 6-phenyl-2-[((piperidin-4-ylmethyl)-piperazin-1YL) or piperazin 1-ylmethyl)-piperidin-1-yl)]-imidazo[2,1-B][1,3,4]thiadiazole derivatives and their use | 20090225 |
WO-2010097798-A1 | 6-phenyl-2-[((piperidin-4-ylmethyl)-piperazin-1yl) or piperazin 1-ylmethyl)-piperidin-1-yl)]-imidazo[2,1-b][1,3,4]thiadiazole derivatives and their use | 20090225 |
Complexity: | 403 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 311.2208918 |
Formal Charge: | 0 |
Heavy Atom Count: | 22 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 311.2208918 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 53.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS