1-Benzosuberone - CAS 826-73-3
Catalog: |
BB036877 |
Product Name: |
1-Benzosuberone |
CAS: |
826-73-3 |
Synonyms: |
6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
IUPAC Name: | 6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
Description: | 1-Benzosuberone (CAS# 826-73-3) is used in the synthesis of novel benzosuberone bearing coumarin moieties as potential anticancer agents. |
Molecular Weight: | 160.21 |
Molecular Formula: | C11H12O |
Canonical SMILES: | C1CCC(=O)C2=CC=CC=C2C1 |
InChI: | InChI=1S/C11H12O/c12-11-8-4-2-6-9-5-1-3-7-10(9)11/h1,3,5,7H,2,4,6,8H2 |
InChI Key: | KWHUHTFXMNQHAA-UHFFFAOYSA-N |
Boiling Point: | 274.1 ℃ at 760 mmHg |
Density: | 1.071 g/mL at 25℃(lit.) |
LogP: | 2.59570 |
Publication Number | Title | Priority Date |
WO-2021188392-A1 | Boron-containing cyclic emissive compounds and color conversion film containing the same | 20200320 |
WO-2021146380-A1 | Boron-containing cyclic emissive compounds and color conversion film containing the same | 20200117 |
WO-2021130638-A1 | Diacylglycerol kinase modulating compounds | 20191224 |
WO-2021055713-A1 | Integrin receptor alpha v beta 3 and its ligand involved in chronic itch | 20190920 |
CN-110204468-A | A kind of method of asymmetric synthesis of chiral alpha-thiocyanogen cyclic ketone acid esters compound | 20190531 |
PMID | Publication Date | Title | Journal |
23428964 | 20130401 | Selective aminopeptidase-N (CD13) inhibitors with relevance to cancer chemotherapy | Bioorganic & medicinal chemistry |
21843945 | 20110915 | A novel amino-benzosuberone derivative is a picomolar inhibitor of mammalian aminopeptidase N/CD13 | Bioorganic & medicinal chemistry |
21486212 | 20110501 | Novel mast cell-stabilising amine derivatives of 3,4 dihydronaphthalen-1(2H)-one and 6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-one | Medicinal chemistry (Shariqah (United Arab Emirates)) |
21292493 | 20110215 | Amino-benzosuberone: a novel warhead for selective inhibition of human aminopeptidase-N/CD13 | Bioorganic & medicinal chemistry |
21804900 | 20110101 | Kinetic analysis of some chalcones and synthetic chalcone analogues on the fenton-reaction initiated deoxyribose degradation assay | The open medicinal chemistry journal |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.088815002 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.088815002 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS