1-Amino-9-fluorenone - CAS 6344-62-3
Catalog: |
BB032149 |
Product Name: |
1-Amino-9-fluorenone |
CAS: |
6344-62-3 |
Synonyms: |
1-aminofluoren-9-one |
IUPAC Name: | 1-aminofluoren-9-one |
Description: | 1-Amino-9-fluorenone (CAS# 6344-62-3) is a useful research chemical compound. |
Molecular Weight: | 195.22 |
Molecular Formula: | C13H9NO |
Canonical SMILES: | C1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)N |
InChI: | InChI=1S/C13H9NO/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7H,14H2 |
InChI Key: | KSEPMOMKAQKOSM-UHFFFAOYSA-N |
Boiling Point: | 406.2 °C at 760 mmHg |
Density: | 1.327 g/cm3 |
Appearance: | Yellow crystalline powder |
MDL: | MFCD00001158 |
LogP: | 3.06140 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-108706780-A | A kind of heavy metal liquid waste treating apparatus using novel heavy metal adsorption particle | 20180629 |
TW-201920306-A | Method for producing metal microparticle composite | 20170725 |
WO-2019022151-A1 | Method of manufacturing metal fine particle complex | 20170725 |
JP-WO2019022151-A1 | Method for producing metal fine particle composite | 20170725 |
US-2020136045-A1 | Materials for electronic devices | 20170628 |
PMID | Publication Date | Title | Journal |
21126022 | 20110113 | Virtual screening identification of nonfolate compounds, including a CNS drug, as antiparasitic agents inhibiting pteridine reductase | Journal of medicinal chemistry |
20806896 | 20100923 | Effects of conformational restriction of 2-amino-3-benzoylthiophenes on A(1) adenosine receptor modulation | Journal of medicinal chemistry |
19821474 | 20091207 | Ultrafast relaxation dynamics of the excited states of 1-amino- and 1-(N,N-dimethylamino)-fluoren-9-ones | Chemphyschem : a European journal of chemical physics and physical chemistry |
Complexity: | 276 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.068413911 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.068413911 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS