1-Amino-2-naphthonitrile - CAS 3100-67-2
Catalog: |
BB020781 |
Product Name: |
1-Amino-2-naphthonitrile |
CAS: |
3100-67-2 |
Synonyms: |
1-amino-2-naphthalenecarbonitrile; 1-aminonaphthalene-2-carbonitrile |
IUPAC Name: | 1-aminonaphthalene-2-carbonitrile |
Description: | 1-Amino-2-naphthonitrile (CAS# 3100-67-2) is a useful research chemical. |
Molecular Weight: | 168.19 |
Molecular Formula: | C11H8N2 |
Canonical SMILES: | C1=CC=C2C(=C1)C=CC(=C2N)C#N |
InChI: | InChI=1S/C11H8N2/c12-7-9-6-5-8-3-1-2-4-10(8)11(9)13/h1-6H,13H2 |
InChI Key: | XECDNKIIZWFBHB-UHFFFAOYSA-N |
LogP: | 2.87488 |
Publication Number | Title | Priority Date |
EP-3275970-A1 | Organic light emitting compound and organic light emitting diode including the same | 20160727 |
EP-3275970-B1 | Organic light emitting compound and organic light emitting diode including the same | 20160727 |
US-2018040834-A1 | Organic light emitting compound and organic light emitting diode including the same | 20160727 |
US-10957865-B2 | Organic light emitting compound and organic light emitting diode including the same | 20160727 |
US-2021057655-A1 | Organic light emitting compound and organic light emitting diode including the same | 20160727 |
Complexity: | 228 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 168.068748264 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 168.068748264 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 49.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS