1-acetylpiperidine-3-carboxylic acid - CAS 2637-76-5
Catalog: |
BB019258 |
Product Name: |
1-acetylpiperidine-3-carboxylic acid |
CAS: |
2637-76-5 |
Synonyms: |
1-acetyl-3-piperidinecarboxylic acid; 1-acetylpiperidine-3-carboxylic acid |
IUPAC Name: | 1-acetylpiperidine-3-carboxylic acid |
Description: | 1-acetylpiperidine-3-carboxylic acid (CAS# 2637-76-5) is a useful research chemical. |
Molecular Weight: | 171.19 |
Molecular Formula: | C8H13NO3 |
Canonical SMILES: | CC(=O)N1CCCC(C1)C(=O)O |
InChI: | InChI=1S/C8H13NO3/c1-6(10)9-4-2-3-7(5-9)8(11)12/h7H,2-5H2,1H3,(H,11,12) |
InChI Key: | ODPIDTOGVIDBLN-UHFFFAOYSA-N |
Boiling Point: | 374.039 ℃ at 760 mmHg |
Density: | 1.214 g/cm3 |
MDL: | MFCD07348751 |
LogP: | 0.26740 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021062246-A1 | Crf receptor antagonists and methods of use | 20190927 |
WO-2020127200-A1 | Heterocyclic derivatives, pharmaceutical compositions and their use in the treatment, amelioration or prevention of cancer | 20181217 |
EP-3898614-A1 | Heterocyclic derivatives, pharmaceutical compositions and their use in the treatment, amelioration or prevention of cancer | 20181217 |
CN-110167944-A | Substituted pyrazolo azepine * -4- ketone and its purposes as phosphodiesterase inhibitors | 20161212 |
EP-3092229-B1 | Pyrrolidinyl sulfone derivatives and their use as ror gamma modulators | 20140106 |
Complexity: | 203 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 171.08954328 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 171.08954328 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 57.6 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS