N-Acetyl-4-piperidone - CAS 32161-06-1
Catalog: |
BB021208 |
Product Name: |
N-Acetyl-4-piperidone |
CAS: |
32161-06-1 |
Synonyms: |
1-acetylpiperidin-4-one |
IUPAC Name: | 1-acetylpiperidin-4-one |
Description: | 1-Acetyl-4-piperidone (CAS# 32161-06-1) is a useful research chemical. |
Molecular Weight: | 141.17 |
Molecular Formula: | C7H11NO2 |
Canonical SMILES: | CC(=O)N1CCC(=O)CC1 |
InChI: | InChI=1S/C7H11NO2/c1-6(9)8-4-2-7(10)3-5-8/h2-5H2,1H3 |
InChI Key: | NNFOVLFUGLWWCL-UHFFFAOYSA-N |
Boiling Point: | 218 ℃ |
Purity: | 97+ % |
Density: | 1.146 g/cm3 |
Appearance: | Clear orange oily liquid |
LogP: | 0.13570 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021139817-A1 | Polycyclic compound acting as kinase inhibitor | 20200110 |
US-2021139517-A1 | Bicyclic heteroaryl compounds and uses thereof | 20191108 |
WO-2021092115-A1 | Bicyclic heteroaryl compounds and uses thereof | 20191108 |
CN-112645946-A | Substituted tricyclic compound as PRMT5 inhibitor and application thereof | 20191012 |
WO-2021068953-A1 | Substituted tricyclic compound as prmt5 inhibitor and use thereof | 20191012 |
Complexity: | 155 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 141.078978594 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 141.078978594 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 37.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperidones
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS