1-(5-Chloro-3-pyridyl)ethanone - CAS 101945-85-1
Catalog: |
BB000707 |
Product Name: |
1-(5-Chloro-3-pyridyl)ethanone |
CAS: |
101945-85-1 |
Synonyms: |
1-(5-chloro-3-pyridinyl)ethanone; 1-(5-chloropyridin-3-yl)ethanone |
IUPAC Name: | 1-(5-chloropyridin-3-yl)ethanone |
Description: | 1-(5-Chloro-3-pyridyl)ethanone (CAS# 101945-85-1) is a useful research chemical. |
Molecular Weight: | 155.58 |
Molecular Formula: | C7H6ClNO |
Canonical SMILES: | CC(=O)C1=CC(=CN=C1)Cl |
InChI: | InChI=1S/C7H6ClNO/c1-5(10)6-2-7(8)4-9-3-6/h2-4H,1H3 |
InChI Key: | CHFDQPBFYDYBIJ-UHFFFAOYSA-N |
MDL: | MFCD11847431 |
LogP: | 0.00000 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2017505318-A | Dihydropyrrolopyridine inhibitors of ROR gamma | 20140203 |
JP-6466461-B2 | Dihydropyrrolopyridine inhibitors of ROR gamma | 20140203 |
EP-3042900-A1 | Novel morpholine derivative or salt thereof | 20130829 |
JP-6074043-B2 | Novel morpholine derivative or salt thereof | 20130829 |
JP-WO2015030057-A1 | Novel morpholine derivative or salt thereof | 20130829 |
Complexity: | 138 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.0137915 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.0137915 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS