1-[4-(Trifluoromethyl)phenyl]cyclobutanecarbonitrile - CAS 29786-44-5
Catalog: |
BB020321 |
Product Name: |
1-[4-(Trifluoromethyl)phenyl]cyclobutanecarbonitrile |
CAS: |
29786-44-5 |
Synonyms: |
1-[4-(trifluoromethyl)phenyl]-1-cyclobutanecarbonitrile; 1-[4-(trifluoromethyl)phenyl]cyclobutane-1-carbonitrile |
IUPAC Name: | 1-[4-(trifluoromethyl)phenyl]cyclobutane-1-carbonitrile |
Description: | 1-[4-(Trifluoromethyl)phenyl]cyclobutanecarbonitrile (CAS# 29786-44-5) is a useful research chemical. |
Molecular Weight: | 225.21 |
Molecular Formula: | C12H10F3N |
Canonical SMILES: | C1CC(C1)(C#N)C2=CC=C(C=C2)C(F)(F)F |
InChI: | InChI=1S/C12H10F3N/c13-12(14,15)10-4-2-9(3-5-10)11(8-16)6-1-7-11/h2-5H,1,6-7H2 |
InChI Key: | MFKULHDHOJHBAX-UHFFFAOYSA-N |
MDL: | MFCD11036721 |
LogP: | 3.65068 |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CN-108699048-A | As 6 inhibitor oxadiazoles amine derivatives compounds of histone deacetylase and include the pharmaceutical composition of the compound | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 300 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 225.07653381 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 225.07653381 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
-
[30360-19-1]
N,N'-Diethyl-N''-isopropyl-1,3,5-triazine-2,4,6-triamine
-
[91-04-3]
2,6-Bis(hydroxymethyl)-p-cresol
-
[144222-34-4]
(1R,2R)-(-)-N-p-Tosyl-1,2-diphenylethylenediamine
-
[3553-80-8]
Ethyl diethylcarbamate
-
[31295-50-8]
N'-[2-[2-(2-piperazin-1-ylethylamino)ethylamino]ethyl]ethane-1,2-diamine
-
[94086-78-9]
Isopropyl 4-[4-[N,N-bis(2-hydroxyethyl)amino]phenyl]butyrate
INDUSTRY LEADERS TRUST OUR PRODUCTS