1-(4-Methoxyphenyl)cyclobutanecarbonitrile - CAS 29786-45-6
Catalog: |
BB020322 |
Product Name: |
1-(4-Methoxyphenyl)cyclobutanecarbonitrile |
CAS: |
29786-45-6 |
Synonyms: |
1-(4-methoxyphenyl)-1-cyclobutanecarbonitrile; 1-(4-methoxyphenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(4-methoxyphenyl)cyclobutane-1-carbonitrile |
Description: | 1-(4-Methoxyphenyl)cyclobutanecarbonitrile (CAS# 29786-45-6 ) is a useful research chemical. |
Molecular Weight: | 187.24 |
Molecular Formula: | C12H13NO |
Canonical SMILES: | COC1=CC=C(C=C1)C2(CCC2)C#N |
InChI: | InChI=1S/C12H13NO/c1-14-11-5-3-10(4-6-11)12(9-13)7-2-8-12/h3-6H,2,7-8H2,1H3 |
InChI Key: | KKMVJOZLYNVVSK-UHFFFAOYSA-N |
MDL: | MFCD00297175 |
LogP: | 2.64048 |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
KR-101839137-B1 | Oxadiazole Amine Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20151012 |
Complexity: | 240 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 187.099714038 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 187.099714038 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 33 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
-
[79551-14-7]
Ferene Disodium Salt
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[1984-15-2]
Methylenediphosphonic acid
-
[87117-22-4]
1,4-Bis(2-ethylhexyl)benzene
-
[35153-16-3]
(Z)-10-Tetradecenyl Acetate
-
[104517-96-6]
Ioversol related compound B
INDUSTRY LEADERS TRUST OUR PRODUCTS