1,4-Dimethylimidazole-5-carboxylic Acid - CAS 78449-67-9
Catalog: |
BB036170 |
Product Name: |
1,4-Dimethylimidazole-5-carboxylic Acid |
CAS: |
78449-67-9 |
Synonyms: |
3,5-dimethyl-4-imidazolecarboxylic acid; 3,5-dimethylimidazole-4-carboxylic acid |
IUPAC Name: | 3,5-dimethylimidazole-4-carboxylic acid |
Description: | 1,4-Dimethylimidazole-5-carboxylic Acid (CAS# 78449-67-9) is a useful research chemical. |
Molecular Weight: | 140.14 |
Molecular Formula: | C6H8N2O2 |
Canonical SMILES: | CC1=C(N(C=N1)C)C(=O)O |
InChI: | InChI=1S/C6H8N2O2/c1-4-5(6(9)10)8(2)3-7-4/h3H,1-2H3,(H,9,10) |
InChI Key: | OPSKQGQJCODPET-UHFFFAOYSA-N |
LogP: | 0.42670 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3822268-A1 | Substituted hydantoinamides as adamts7 antagonists | 20191115 |
WO-2020085493-A1 | Novel indazole compound or salt thereof | 20181026 |
US-2021107914-A1 | OX2R Compounds | 20180327 |
US-2021163494-A1 | OX2R Compounds | 20180327 |
US-2013281324-A1 | Bi-functinal complexes and methods for making and using such complexes | 20100416 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 140.058577502 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 140.058577502 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS