1,4-Dibromo-2-chlorobenzene - CAS 3460-24-0
Catalog: |
BB022202 |
Product Name: |
1,4-Dibromo-2-chlorobenzene |
CAS: |
3460-24-0 |
Synonyms: |
1,4-dibromo-2-chlorobenzene; 1,4-dibromo-2-chlorobenzene |
IUPAC Name: | 1,4-dibromo-2-chlorobenzene |
Description: | 1,4-Dibromo-2-chlorobenzene (CAS# 3460-24-0) is a useful research chemical. |
Molecular Weight: | 270.35 |
Molecular Formula: | C6H3Br2Cl |
Canonical SMILES: | C1=CC(=C(C=C1Br)Cl)Br |
InChI: | InChI=1S/C6H3Br2Cl/c7-4-1-2-5(8)6(9)3-4/h1-3H |
InChI Key: | LOWQAATYMJIWOG-UHFFFAOYSA-N |
Boiling Point: | 258.5 °C at 760 mmHg |
Density: | 2.021 g/cm3 |
MDL: | MFCD00018094 |
LogP: | 3.86500 |
Publication Number | Title | Priority Date |
CN-112457180-A | Preparation method of aromatic dicarboxylic acid derivative | 20201106 |
JP-WO2017209297-A1 | Triarylene compound and method for producing the same | 20160602 |
WO-2017209297-A1 | Triarylene compound and method for producing same | 20160602 |
KR-102044945-B1 | Organic compound and organic optoelectronic device and display device | 20160328 |
KR-102044946-B1 | Organic compound and organic optoelectronic device and display device | 20160203 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 269.82695 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.829 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS