1,4-Dibromo-2,3-difluorobenzene - CAS 156682-52-9
Catalog: |
BB011245 |
Product Name: |
1,4-Dibromo-2,3-difluorobenzene |
CAS: |
156682-52-9 |
Synonyms: |
1,4-dibromo-2,3-difluorobenzene; 1,4-dibromo-2,3-difluorobenzene |
IUPAC Name: | 1,4-dibromo-2,3-difluorobenzene |
Description: | 1,4-Dibromo-2,3-difluorobenzene (CAS# 156682-52-9) is a halogenated benzene used in the preparation of various biologically active compounds such as non-nucleoside reverse transcriptase inhibitors. 1,4-Dibromo-2,3-difluorobenzene is also used in the synthesis of conjugated polymers for organic photovoltaics. |
Molecular Weight: | 271.88 |
Molecular Formula: | C6H2Br2F2 |
Canonical SMILES: | C1=CC(=C(C(=C1Br)F)F)Br |
InChI: | InChI=1S/C6H2Br2F2/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
InChI Key: | RGXGEFSBDPGCEU-UHFFFAOYSA-N |
Boiling Point: | 211.9 °C at 760 mmHg |
Density: | 2.087 g/cm3 |
LogP: | 3.48980 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P264, P280, P302+P352, P305+P351+P338, P321, P332+P313, P337+P313, and P362 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113042011-A | Fluorine-containing conjugated microporous polymer and preparation method and application thereof | 20210322 |
US-2021122877-A1 | Conjugated polymer and perovskite solar cell including same | 20191028 |
KR-20210050288-A | Conjugated polymer for perovskite solar cell and perovskite solar cell comprising the same | 20191028 |
WO-2021011913-A1 | Tau-protein targeting compounds and associated methods of use | 20190717 |
WO-2020257161-A1 | Biaryl dialkyl phosphine oxide fpr2 agonists | 20190618 |
Complexity: | 106 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 271.84708 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 269.84913 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS