1-(4-Chlorophenyl)cyclopropanamine Hydrochloride - CAS 1009102-44-6
Catalog: |
BB000384 |
Product Name: |
1-(4-Chlorophenyl)cyclopropanamine Hydrochloride |
CAS: |
1009102-44-6 |
Synonyms: |
1-(4-chlorophenyl)-1-cyclopropanamine;hydrochloride; 1-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
IUPAC Name: | 1-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
Description: | 1-(4-Chlorophenyl)cyclopropanamine Hydrochloride (CAS# 1009102-44-6) is a useful research chemical. |
Molecular Weight: | 204.10 |
Molecular Formula: | C9H11Cl2N |
Canonical SMILES: | C1CC1(C2=CC=C(C=C2)Cl)N.Cl |
InChI: | InChI=1S/C9H10ClN.ClH/c10-8-3-1-7(2-4-8)9(11)5-6-9;/h1-4H,5-6,11H2;1H |
InChI Key: | UQTQBRJXTQDWHY-UHFFFAOYSA-N |
MDL: | MFCD07995727 |
LogP: | 3.79010 |
GHS Hazard Statement: | H318 (95.12%): Causes serious eye damage [Danger Serious eye damage/eye irritation] |
Precautionary Statement: | P280, P305+P351+P338, and P310 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020097609-A1 | Gpr139 receptor modulators | 20181109 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 146 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 203.0268547 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 203.0268547 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS