1-(4-Chlorophenyl)cyclobutanamine Hydrochloride - CAS 1228878-71-4
Catalog: |
BB005587 |
Product Name: |
1-(4-Chlorophenyl)cyclobutanamine Hydrochloride |
CAS: |
1228878-71-4 |
Synonyms: |
1-(4-chlorophenyl)-1-cyclobutanamine;hydrochloride; 1-(4-chlorophenyl)cyclobutan-1-amine;hydrochloride |
IUPAC Name: | 1-(4-chlorophenyl)cyclobutan-1-amine;hydrochloride |
Description: | 1-(4-Chlorophenyl)cyclobutanamine Hydrochloride (CAS# 1228878-71-4) is a useful research chemical. |
Molecular Weight: | 218.12 |
Molecular Formula: | C10H13Cl2N |
Canonical SMILES: | C1CC(C1)(C2=CC=C(C=C2)Cl)N.Cl |
InChI: | InChI=1S/C10H12ClN.ClH/c11-9-4-2-8(3-5-9)10(12)6-1-7-10;/h2-5H,1,6-7,12H2;1H |
InChI Key: | JQWRLVGLEWMOSA-UHFFFAOYSA-N |
LogP: | 4.18020 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
KR-101839137-B1 | Oxadiazole Amine Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20151012 |
Complexity: | 157 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 217.0425048 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 217.0425048 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS