1-(4-Chlorophenyl)cyclopentanecarbonitrile - CAS 64399-26-4
Catalog: |
BB032459 |
Product Name: |
1-(4-Chlorophenyl)cyclopentanecarbonitrile |
CAS: |
64399-26-4 |
Synonyms: |
1-(4-chlorophenyl)-1-cyclopentanecarbonitrile; 1-(4-chlorophenyl)cyclopentane-1-carbonitrile |
IUPAC Name: | 1-(4-chlorophenyl)cyclopentane-1-carbonitrile |
Description: | 1-(4-Chlorophenyl)cyclopentanecarbonitrile (CAS# 64399-26-4) is a useful research chemical compound. |
Molecular Weight: | 205.68 |
Molecular Formula: | C12H12ClN |
Canonical SMILES: | C1CCC(C1)(C#N)C2=CC=C(C=C2)Cl |
InChI: | InChI=1S/C12H12ClN/c13-11-5-3-10(4-6-11)12(9-14)7-1-2-8-12/h3-6H,1-2,7-8H2 |
InChI Key: | TXVNBTOIDITCBF-UHFFFAOYSA-N |
Boiling Point: | 334.7 ℃ at 760 mmHg |
Density: | 1.17 g/cm3 |
LogP: | 3.67538 |
Publication Number | Title | Priority Date |
US-2020087331-A1 | Chemoselective methylene hydroxylation in aromatic molecules | 20180913 |
US-10961266-B2 | Chemoselective methylene hydroxylation in aromatic molecules | 20180913 |
AU-2014204889-A1 | Pyrimidone derivatives and their use in the treatment, amelioration or prevention of a viral disease | 20130108 |
CA-2894642-A1 | Pyrimidone derivatives and their use in the treatment, amelioration or prevention of a viral disease | 20130108 |
CN-104918942-A | Pyrimidone derivatives and their use in the treatment, amelioration or prevention of a viral disease | 20130108 |
Complexity: | 238 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.0658271 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.0658271 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS