1-(4-Chloro-3-fluorophenyl)cyclopropanamine - CAS 1260790-76-8
Catalog: |
BB006396 |
Product Name: |
1-(4-Chloro-3-fluorophenyl)cyclopropanamine |
CAS: |
1260790-76-8 |
Synonyms: |
1-(4-chloro-3-fluorophenyl)-1-cyclopropanamine; 1-(4-chloro-3-fluorophenyl)cyclopropan-1-amine |
IUPAC Name: | 1-(4-chloro-3-fluorophenyl)cyclopropan-1-amine |
Description: | 1-(4-Chloro-3-fluorophenyl)cyclopropanamine (CAS# 1260790-76-8 ) is a useful research chemical. |
Molecular Weight: | 185.63 |
Molecular Formula: | C9H9ClFN |
Canonical SMILES: | C1CC1(C2=CC(=C(C=C2)Cl)F)N |
InChI: | InChI=1S/C9H9ClFN/c10-7-2-1-6(5-8(7)11)9(12)3-4-9/h1-2,5H,3-4,12H2 |
InChI Key: | IXHCNCRLGZJHBK-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
WO-2021071843-A1 | Muscarinic acetylcholine m1 receptor antagonists | 20191007 |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 185.0407551 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 185.0407551 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS