1-[3-(Trifluoromethyl)phenyl]cyclopropanamine Hydrochloride - CAS 1108698-58-3
Catalog: |
BB002682 |
Product Name: |
1-[3-(Trifluoromethyl)phenyl]cyclopropanamine Hydrochloride |
CAS: |
1108698-58-3 |
Synonyms: |
1-[3-(trifluoromethyl)phenyl]-1-cyclopropanamine;hydrochloride; 1-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride |
IUPAC Name: | 1-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride |
Description: | 1-[3-(Trifluoromethyl)phenyl]cyclopropanamine Hydrochloride (CAS# 1108698-58-3) is a useful research chemical. |
Molecular Weight: | 237.65 |
Molecular Formula: | C10H11ClF3N |
Canonical SMILES: | C1CC1(C2=CC(=CC=C2)C(F)(F)F)N.Cl |
InChI: | InChI=1S/C10H10F3N.ClH/c11-10(12,13)8-3-1-2-7(6-8)9(14)4-5-9;/h1-3,6H,4-5,14H2;1H |
InChI Key: | XHYOSQMVVNPZEP-UHFFFAOYSA-N |
LogP: | 4.15550 |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
RU-2695133-C1 | Oxadiazolamine derivatives as histone deacetylase 6 inhibitor and pharmaceutical composition containing them | 20151012 |
Complexity: | 220 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 237.0532115 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 237.0532115 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS