1-[3-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile - CAS 124305-68-6
Catalog: |
BB005872 |
Product Name: |
1-[3-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile |
CAS: |
124305-68-6 |
Synonyms: |
1-[3-(trifluoromethyl)phenyl]-1-cyclopropanecarbonitrile; 1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile |
IUPAC Name: | 1-[3-(trifluoromethyl)phenyl]cyclopropane-1-carbonitrile |
Description: | 1-[3-(Trifluoromethyl)phenyl]cyclopropanecarbonitrile (CAS# 124305-68-6 ) is a useful research chemical. |
Molecular Weight: | 211.18 |
Molecular Formula: | C11H8F3N |
Canonical SMILES: | C1CC1(C#N)C2=CC(=CC=C2)C(F)(F)F |
InChI: | InChI=1S/C11H8F3N/c12-11(13,14)9-3-1-2-8(6-9)10(7-15)4-5-10/h1-3,6H,4-5H2 |
InChI Key: | CRIZCGCPHXFSCH-UHFFFAOYSA-N |
MDL: | MFCD07374416 |
LogP: | 3.26058 |
Publication Number | Title | Priority Date |
EP-3811945-A1 | Compounds for treating and preventing growth hormone receptor-dependent conditions | 20191025 |
WO-2021078995-A1 | Selective polypeptide synthesis stalling assay and compound | 20191025 |
EP-2530078-A1 | Thiazole derivative | 20100127 |
JP-WO2011093352-A1 | Thiazole derivative | 20100127 |
WO-2011093352-A1 | Thiazole derivative | 20100127 |
Complexity: | 295 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 211.06088375 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 211.06088375 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS