1-(3-Methoxyphenyl)cyclobutanecarbonitrile - CAS 74205-15-5
Catalog: |
BB035021 |
Product Name: |
1-(3-Methoxyphenyl)cyclobutanecarbonitrile |
CAS: |
74205-15-5 |
Synonyms: |
1-(3-methoxyphenyl)-1-cyclobutanecarbonitrile; 1-(3-methoxyphenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(3-methoxyphenyl)cyclobutane-1-carbonitrile |
Description: | 1-(3-Methoxyphenyl)cyclobutanecarbonitrile (CAS# 74205-15-5) is a useful research chemical. |
Molecular Weight: | 187.24 |
Molecular Formula: | C12H13NO |
Canonical SMILES: | COC1=CC=CC(=C1)C2(CCC2)C#N |
InChI: | InChI=1S/C12H13NO/c1-14-11-5-2-4-10(8-11)12(9-13)6-3-7-12/h2,4-5,8H,3,6-7H2,1H3 |
InChI Key: | MFGRIOOSDBSHEH-UHFFFAOYSA-N |
MDL: | MFCD09414740 |
LogP: | 2.64048 |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
KR-101839137-B1 | Oxadiazole Amine Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20151012 |
Complexity: | 248 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 187.099714038 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 187.099714038 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 33 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS