1-(3-Fluorophenyl)cyclopentanamine - CAS 1011361-33-3
Catalog: |
BB000449 |
Product Name: |
1-(3-Fluorophenyl)cyclopentanamine |
CAS: |
1011361-33-3 |
Synonyms: |
1-(3-fluorophenyl)-1-cyclopentanamine; 1-(3-fluorophenyl)cyclopentan-1-amine |
IUPAC Name: | 1-(3-fluorophenyl)cyclopentan-1-amine |
Description: | 1-(3-Fluorophenyl)cyclopentanamine (CAS# 1011361-33-3 ) is a useful research chemical. |
Molecular Weight: | 179.23 |
Molecular Formula: | C11H14FN |
Canonical SMILES: | C1CCC(C1)(C2=CC(=CC=C2)F)N |
InChI: | InChI=1S/C11H14FN/c12-10-5-3-4-9(8-10)11(13)6-1-2-7-11/h3-5,8H,1-2,6-7,13H2 |
InChI Key: | ZWZDMEVJRLKGEN-UHFFFAOYSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
EP-3055293-B1 | Diarylalkylamine rev-erb antagonists and their use as medicaments | 20131009 |
US-2016237057-A1 | Diarylalkylamine rev-erb antagonists and their use as medicaments | 20131009 |
US-2017136009-A1 | Diarylalkylamine rev-erb antagonists and their use as medicaments | 20131009 |
US-9611245-B2 | Diarylalkylamine REV-ERB antagonists and their use as medicaments | 20131009 |
US-9949968-B2 | Diarylalkylamine REV-ERB antagonists and their use as medicaments | 20131009 |
Complexity: | 175 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.111027613 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.111027613 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS