1-(3-Fluorophenyl)cyclohexanol - CAS 1496-35-1
Catalog: |
BB010430 |
Product Name: |
1-(3-Fluorophenyl)cyclohexanol |
CAS: |
1496-35-1 |
Synonyms: |
1-(3-fluorophenyl)-1-cyclohexanol; 1-(3-fluorophenyl)cyclohexan-1-ol |
IUPAC Name: | 1-(3-fluorophenyl)cyclohexan-1-ol |
Description: | 1-(3-Fluorophenyl)cyclohexanol (CAS# 1496-35-1) is a useful research chemical. |
Molecular Weight: | 194.25 |
Molecular Formula: | C12H15FO |
Canonical SMILES: | C1CCC(CC1)(C2=CC(=CC=C2)F)O |
InChI: | InChI=1S/C12H15FO/c13-11-6-4-5-10(9-11)12(14)7-2-1-3-8-12/h4-6,9,14H,1-3,7-8H2 |
InChI Key: | PQSFDHKUPBPVLK-UHFFFAOYSA-N |
LogP: | 2.97740 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-1415986-A1 | Spiro compounds | 20010807 |
EP-1415986-B1 | Spiro isobenzofuranes as neuropeptide y receptor antagonists | 20010807 |
US-2004259890-A1 | Spiro compounds | 20010807 |
US-7205417-B2 | Spiro compounds | 20010807 |
Complexity: | 187 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 194.110693260 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 194.110693260 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS