1,3-Dimethyl-6-hydroxyquinazoline-2,4-dione - CAS 1267663-32-0
Catalog: |
BB006660 |
Product Name: |
1,3-Dimethyl-6-hydroxyquinazoline-2,4-dione |
CAS: |
1267663-32-0 |
Synonyms: |
6-hydroxy-1,3-dimethylquinazoline-2,4-dione; 6-hydroxy-1,3-dimethylquinazoline-2,4-dione |
IUPAC Name: | 6-hydroxy-1,3-dimethylquinazoline-2,4-dione |
Description: | 1,3-Dimethyl-6-hydroxyquinazoline-2,4-dione (CAS# 1267663-32-0) is a useful research chemical. |
Molecular Weight: | 206.20 |
Molecular Formula: | C10H10N2O3 |
Canonical SMILES: | CN1C2=C(C=C(C=C2)O)C(=O)N(C1=O)C |
InChI: | InChI=1S/C10H10N2O3/c1-11-8-4-3-6(13)5-7(8)9(14)12(2)10(11)15/h3-5,13H,1-2H3 |
InChI Key: | AGHJHORNXUKEBY-UHFFFAOYSA-N |
LogP: | -0.05720 |
Publication Number | Title | Priority Date |
JP-2012184225-A | Pharmaceutical composition | 20110218 |
AU-2010285621-A1 | Nitrogen-containing compounds and pharmaceutical compositions thereof for the treatment of atrial fibrillation | 20090821 |
CA-2771579-A1 | Nitrogen-containing compound and pharmaceutical composition | 20090821 |
EP-2746272-A1 | Nitrogen-containing compounds and pharmaceutical compositions thereof for the treatment of atrial fibrillation | 20090821 |
JP-2013502378-A | Nitrogen-containing compounds and pharmaceutical compositions | 20090821 |
Complexity: | 305 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 206.06914219 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 206.06914219 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 60.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS