1,3-Dihydroxy-2-naphthoic Acid - CAS 3147-58-8
Catalog: |
BB020939 |
Product Name: |
1,3-Dihydroxy-2-naphthoic Acid |
CAS: |
3147-58-8 |
Synonyms: |
1,3-dihydroxy-2-naphthalenecarboxylic acid; 1,3-dihydroxynaphthalene-2-carboxylic acid |
IUPAC Name: | 1,3-dihydroxynaphthalene-2-carboxylic acid |
Description: | 1,3-Dihydroxy-2-naphthoic Acid (CAS# 3147-58-8) is a useful research chemical compound. |
Molecular Weight: | 204.18 |
Molecular Formula: | C11H8O4 |
Canonical SMILES: | C1=CC=C2C(=C1)C=C(C(=C2O)C(=O)O)O |
InChI: | InChI=1S/C11H8O4/c12-8-5-6-3-1-2-4-7(6)10(13)9(8)11(14)15/h1-5,12-13H,(H,14,15) |
InChI Key: | USZZLTVYRPLBMB-UHFFFAOYSA-N |
LogP: | 1.94920 |
Publication Number | Title | Priority Date |
US-2021149302-A1 | Resist composition and method of forming resist pattern | 20191114 |
WO-2021080359-A1 | Bicyclic compound and use thereof | 20191023 |
US-2021101892-A1 | Bicyclic compound and use thereof | 20191002 |
WO-2021066578-A1 | Bicyclic compound and use thereof | 20191002 |
WO-2020195428-A1 | Radiation-sensitive resin composition and method for forming resist pattern | 20190328 |
Complexity: | 253 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.04225873 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.04225873 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 77.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS