1-(3-Chloropropyl)pyrrolidin-2-one - CAS 91152-30-6
Catalog: |
BB040060 |
Product Name: |
1-(3-Chloropropyl)pyrrolidin-2-one |
CAS: |
91152-30-6 |
Synonyms: |
1-(3-chloropropyl)-2-pyrrolidinone; 1-(3-chloropropyl)pyrrolidin-2-one |
IUPAC Name: | 1-(3-chloropropyl)pyrrolidin-2-one |
Description: | 1-(3-Chloropropyl)pyrrolidin-2-one (CAS# 91152-30-6) is a useful research chemical. |
Molecular Weight: | 161.63 |
Molecular Formula: | C7H12ClNO |
Canonical SMILES: | C1CC(=O)N(C1)CCCCl |
InChI: | InChI=1S/C7H12ClNO/c8-4-2-6-9-5-1-3-7(9)10/h1-6H2 |
InChI Key: | LNLIBBYAXDZTNJ-UHFFFAOYSA-N |
LogP: | 1.17560 |
Publication Number | Title | Priority Date |
US-2021130326-A1 | Ras inhibitors | 20191104 |
WO-2021091967-A1 | Ras inhibitors | 20191104 |
US-10358574-B2 | Coating compositions containing lactam-functionalized polymer | 20160701 |
US-10370482-B2 | Lactam-functionalized polymer, compositions and applications thereof | 20160701 |
US-2018002480-A1 | Lactam-functionalized polymer, compositions and applications thereof | 20160701 |
Complexity: | 127 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 161.0607417 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 161.0607417 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 20.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS