1-(3-Chlorophenyl)cyclobutanamine - CAS 158943-22-7
Catalog: |
BB011477 |
Product Name: |
1-(3-Chlorophenyl)cyclobutanamine |
CAS: |
158943-22-7 |
Synonyms: |
1-(3-chlorophenyl)-1-cyclobutanamine; 1-(3-chlorophenyl)cyclobutan-1-amine |
IUPAC Name: | 1-(3-chlorophenyl)cyclobutan-1-amine |
Description: | 1-(3-Chlorophenyl)cyclobutanamine (CAS# 158943-22-7 ) is a useful research chemical. |
Molecular Weight: | 181.66 |
Molecular Formula: | C10H12ClN |
Canonical SMILES: | C1CC(C1)(C2=CC(=CC=C2)Cl)N |
InChI: | InChI=1S/C10H12ClN/c11-9-4-1-3-8(7-9)10(12)5-2-6-10/h1,3-4,7H,2,5-6,12H2 |
InChI Key: | ZSZAJZSGPJCTML-UHFFFAOYSA-N |
LogP: | 0.00000 |
Publication Number | Title | Priority Date |
WO-2017065473-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
TW-200817336-A | Substituted arylimidazolones and -triazolones and the use thereof | 20060523 |
US-2009312381-A1 | Substituted Arylimidazolone and Triazolone as Inhibitors of Vasopressin Receptors | 20060523 |
US-2013005704-A1 | Substituted arylimidazolone and triazolone as inhibitors of vasopressin receptors | 20060523 |
US-8084481-B2 | Substituted arylimidazolone and triazolone as inhibitors of vasopressin receptors | 20060523 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 181.0658271 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 181.0658271 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS