1-(3-Chlorophenyl)-4-oxocyclohexanecarboxylic Acid - CAS 887978-71-4
Catalog: |
BB039243 |
Product Name: |
1-(3-Chlorophenyl)-4-oxocyclohexanecarboxylic Acid |
CAS: |
887978-71-4 |
Synonyms: |
1-(3-chlorophenyl)-4-oxo-1-cyclohexanecarboxylic acid; 1-(3-chlorophenyl)-4-oxocyclohexane-1-carboxylic acid |
IUPAC Name: | 1-(3-chlorophenyl)-4-oxocyclohexane-1-carboxylic acid |
Description: | 1-(3-Chlorophenyl)-4-oxocyclohexanecarboxylic Acid (CAS# 887978-71-4) is a useful research chemical. |
Molecular Weight: | 252.69 |
Molecular Formula: | C13H13ClO3 |
Canonical SMILES: | C1CC(CCC1=O)(C2=CC(=CC=C2)Cl)C(=O)O |
InChI: | InChI=1S/C13H13ClO3/c14-10-3-1-2-9(8-10)13(12(16)17)6-4-11(15)5-7-13/h1-3,8H,4-7H2,(H,16,17) |
InChI Key: | RTHQIXYCYJHTTI-UHFFFAOYSA-N |
LogP: | 2.80550 |
Publication Number | Title | Priority Date |
CA-1093553-A | Novel 4-amino-4-arylcyclohexanones and their ketals | 19760603 |
CA-1100516-A | 4-amino-4-arylcyclohexanones and their ketals | 19760603 |
CH-641177-A5 | Method for producing new 4-amino-4-arylcyclohexanone compounds. | 19760603 |
US-4065573-A | 4-Amino-4-phenylcyclohexanone ketal compositions and process of use | 19760603 |
US-4180584-A | 4-Pyrrolidino-cyclohexanone ketals | 19760603 |
Complexity: | 317 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 252.055322 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 252.055322 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 54.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS