1,3-Bis(dimethylamino)-2-propanol - CAS 5966-51-8
Catalog: |
BB030452 |
Product Name: |
1,3-Bis(dimethylamino)-2-propanol |
CAS: |
5966-51-8 |
Synonyms: |
1,3-bis(dimethylamino)propan-2-ol |
IUPAC Name: | 1,3-bis(dimethylamino)propan-2-ol |
Description: | 1,3-Bis(dimethylamino)-2-propanol (CAS# 5966-51-8) is a useful research chemical compound. |
Molecular Weight: | 146.23 |
Molecular Formula: | C7H18N2O |
Canonical SMILES: | CN(C)CC(CN(C)C)O |
InChI: | InChI=1S/C7H18N2O/c1-8(2)5-7(10)6-9(3)4/h7,10H,5-6H2,1-4H3 |
InChI Key: | JGVZJRHAZOBPMW-UHFFFAOYSA-N |
Boiling Point: | 181.5 ℃ at 760 mmHg |
Density: | 0.897 g/cm3 |
Appearance: | Colorless to yellow liquid |
LogP: | -0.52950 |
GHS Hazard Statement: | H315 (97.5%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111690110-A | Combined polyether polyol containing polyurethane catalyst containing active group and preparation method thereof | 20200622 |
WO-2021177944-A1 | Catalyst composition for polyurethanes | 20200303 |
EP-3838545-A1 | Polyol mixtures and their use in the production of fine cellular polyurethane foams | 20191217 |
CN-110982012-A | Novel amphoteric acrylamide polymer flocculant and preparation method thereof | 20191118 |
CN-110982012-B | Amphoteric acrylamide polymer flocculant and preparation method thereof | 20191118 |
PMID | Publication Date | Title | Journal |
22624496 | 20120618 | Hexanuclear copper(II) cages built on a central {μ3-O···H···μ3-O} moiety, 1,3-bis(dimethylamino)-2-propanolato and capping R-phosphonates: crystal structures, magnetic behavior, and DFT studies | Inorganic chemistry |
22693566 | 20120101 | Receptor-targeting phthalocyanine photosensitizer for improving antitumor photocytotoxicity | PloS one |
20863087 | 20101018 | Syntheses, structures, and magnetic properties of two kinds of unique heterometallic chains with mixed-bridging ligands of tricyanometalate and alkoxide | Inorganic chemistry |
19885542 | 20091128 | Octanuclear manganese(II,III) clusters stabilized with diamino-alcoxo ligands | Dalton transactions (Cambridge, England : 2003) |
18808109 | 20081020 | Organocadmium aminoalcoholates: synthesis, structure, and materials chemistry | Inorganic chemistry |
Complexity: | 73.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 146.141913202 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 146.141913202 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 26.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS