1-(3,5-Difluorophenyl)cyclobutanecarbonitrile - CAS 1249471-25-7
Catalog: |
BB006022 |
Product Name: |
1-(3,5-Difluorophenyl)cyclobutanecarbonitrile |
CAS: |
1249471-25-7 |
Synonyms: |
1-(3,5-difluorophenyl)-1-cyclobutanecarbonitrile; 1-(3,5-difluorophenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(3,5-difluorophenyl)cyclobutane-1-carbonitrile |
Description: | 1-(3,5-Difluorophenyl)cyclobutanecarbonitrile (CAS# 1249471-25-7 ) is a useful research chemical. |
Molecular Weight: | 193.19 |
Molecular Formula: | C11H9F2N |
Canonical SMILES: | C1CC(C1)(C#N)C2=CC(=CC(=C2)F)F |
InChI: | InChI=1S/C11H9F2N/c12-9-4-8(5-10(13)6-9)11(7-14)2-1-3-11/h4-6H,1-3H2 |
InChI Key: | OJGJWXQDRWERLC-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 254 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 193.07030562 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.07030562 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
-
[875573-66-3]
Estra-1,3,5(10)-triene-3,17-diol,7-(9-bromononyl)-,17-acetate,(7a,17b)-
-
[3821-81-6]
3-Amino-2-fluoropropionic acid
-
[30360-19-1]
N,N'-Diethyl-N''-isopropyl-1,3,5-triazine-2,4,6-triamine
-
[155180-53-3]
RU-59063
-
[332360-02-8]
Mitoguazone dihydrochloride monohydrate
-
[138169-43-4]
MTS Reagent
INDUSTRY LEADERS TRUST OUR PRODUCTS