1-(3,5-Difluorophenyl)cyclobutanamine - CAS 1249123-28-1
Catalog: |
BB006016 |
Product Name: |
1-(3,5-Difluorophenyl)cyclobutanamine |
CAS: |
1249123-28-1 |
Synonyms: |
1-(3,5-difluorophenyl)-1-cyclobutanamine; 1-(3,5-difluorophenyl)cyclobutan-1-amine |
IUPAC Name: | 1-(3,5-difluorophenyl)cyclobutan-1-amine |
Description: | 1-(3,5-Difluorophenyl)cyclobutanamine (CAS# 1249123-28-1 ) is a useful research chemical. |
Molecular Weight: | 183.20 |
Molecular Formula: | C10H11F2N |
Canonical SMILES: | C1CC(C1)(C2=CC(=CC(=C2)F)F)N |
InChI: | InChI=1S/C10H11F2N/c11-8-4-7(5-9(12)6-8)10(13)2-1-3-10/h4-6H,1-3,13H2 |
InChI Key: | XNWWYYGSEBGGLW-UHFFFAOYSA-N |
LogP: | 3.00300 |
Publication Number | Title | Priority Date |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 181 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 183.08595568 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 183.08595568 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
-
[875573-66-3]
Estra-1,3,5(10)-triene-3,17-diol,7-(9-bromononyl)-,17-acetate,(7a,17b)-
-
[30879-49-3]
2'-Nitro-5'-hydroxyacetophenone
-
[2555-49-9]
Ethyl phenoxyacetate
-
[144222-34-4]
(1R,2R)-(-)-N-p-Tosyl-1,2-diphenylethylenediamine
-
[1808-26-0]
Ethyl arachidonate
-
[31295-50-8]
N'-[2-[2-(2-piperazin-1-ylethylamino)ethylamino]ethyl]ethane-1,2-diamine
INDUSTRY LEADERS TRUST OUR PRODUCTS