1-(3,4-Difluorophenyl)cyclopropylamine Hydrochloride - CAS 1186663-16-0
Catalog: |
BB004200 |
Product Name: |
1-(3,4-Difluorophenyl)cyclopropylamine Hydrochloride |
CAS: |
1186663-16-0 |
Synonyms: |
1-(3,4-difluorophenyl)-1-cyclopropanamine;hydrochloride; 1-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
IUPAC Name: | 1-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
Description: | 1-(3,4-Difluorophenyl)cyclopropylamine Hydrochloride (CAS# 1186663-16-0) is a useful research chemical. |
Molecular Weight: | 205.63 |
Molecular Formula: | C9H10ClF2N |
Canonical SMILES: | C1CC1(C2=CC(=C(C=C2)F)F)N.Cl |
InChI: | InChI=1S/C9H9F2N.ClH/c10-7-2-1-6(5-8(7)11)9(12)3-4-9;/h1-2,5H,3-4,12H2;1H |
InChI Key: | BKORYOMJPYTNMW-UHFFFAOYSA-N |
Storage: | Inert atmosphere, Room Temperature |
MDL: | MFCD11052338 |
LogP: | 3.41490 |
Publication Number | Title | Priority Date |
WO-2021071843-A1 | Muscarinic acetylcholine m1 receptor antagonists | 20191007 |
AU-2016338118-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
AU-2016338118-B2 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
Complexity: | 179 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.0469833 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.0469833 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS