1-(2-Thienyl)ethanamine - CAS 6309-16-6
Catalog: |
BB031994 |
Product Name: |
1-(2-Thienyl)ethanamine |
CAS: |
6309-16-6 |
Synonyms: |
1-thiophen-2-ylethanamine; 1-thiophen-2-ylethanamine |
IUPAC Name: | 1-thiophen-2-ylethanamine |
Description: | 1-(2-Thienyl)ethanamine (CAS# 6309-16-6) is a useful research chemical. |
Molecular Weight: | 127.21 |
Molecular Formula: | C6H9NS |
Canonical SMILES: | CC(C1=CC=CS1)N |
InChI: | InChI=1S/C6H9NS/c1-5(7)6-3-2-4-8-6/h2-5H,7H2,1H3 |
InChI Key: | LYJBVRVJQXVVPI-UHFFFAOYSA-N |
Boiling Point: | 195.5 ℃ at 760 mmHg |
Density: | 1.095 g/cm3 |
MDL: | MFCD02734311 |
LogP: | 2.46810 |
GHS Hazard Statement: | H302 (88.37%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P264, P270, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021054144-A1 | Method for producing cyclic imide compound, composition, and compound | 20190920 |
WO-2021050700-A1 | Cyclooxygenase-2 inhibitors and uses thereof | 20190913 |
WO-2019078185-A1 | Cooling agent composition containing 2,2,6-trimethylcyclohexanecarboxylic acid derivative | 20171016 |
EP-3699250-A1 | Cool-sensation imparter composition containing 2,2,6-trimethylcyclohexanecarboxylic acid derivative | 20171016 |
US-2020297607-A1 | Cool-sensation imparter composition containing 2,2,6-trimethylcyclohexanecarboxylic acid derivative | 20171016 |
Complexity: | 74.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 127.04557046 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 127.04557046 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 54.3 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS