1-(2-Thiazolyl)ethylamine - CAS 432047-36-4
Catalog: |
BB025367 |
Product Name: |
1-(2-Thiazolyl)ethylamine |
CAS: |
432047-36-4 |
Synonyms: |
1-(2-thiazolyl)ethanamine; 1-(1,3-thiazol-2-yl)ethanamine |
IUPAC Name: | 1-(1,3-thiazol-2-yl)ethanamine |
Description: | 1-(2-Thiazolyl)ethylamine (CAS# 432047-36-4) is a useful research chemical. |
Molecular Weight: | 128.20 |
Molecular Formula: | C5H8N2S |
Canonical SMILES: | CC(C1=NC=CS1)N |
InChI: | InChI=1S/C5H8N2S/c1-4(6)5-7-2-3-8-5/h2-4H,6H2,1H3 |
InChI Key: | DUOLTCNKKZZNIC-UHFFFAOYSA-N |
MDL: | MFCD02854206 |
LogP: | 1.86310 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P322, P330, P337+P313, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020114947-A1 | Heteroaromatic compounds as vanin inhibitors | 20181203 |
CN-113226462-A | Heteroaromatic compounds as VANIN inhibitors | 20181203 |
EP-3890828-A1 | Heteroaromatic compounds as vanin inhibitors | 20181203 |
KR-20210099093-A | Heteroaromatic Compounds as Vanin Inhibitors | 20181203 |
WO-2019238817-A1 | Bifunctional molecules for targeting rpn11 | 20180613 |
Complexity: | 76.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 128.04081944 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 128.04081944 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 67.2 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS