1-(2-Methylphenyl)cyclopropanemethanamine - CAS 886365-78-2
Catalog: |
BB039059 |
Product Name: |
1-(2-Methylphenyl)cyclopropanemethanamine |
CAS: |
886365-78-2 |
Synonyms: |
[1-(2-methylphenyl)cyclopropyl]methanamine; [1-(2-methylphenyl)cyclopropyl]methanamine |
IUPAC Name: | [1-(2-methylphenyl)cyclopropyl]methanamine |
Description: | 1-(2-Methylphenyl)cyclopropanemethanamine (CAS# 886365-78-2 ) is a useful research chemical. |
Molecular Weight: | 161.24 |
Molecular Formula: | C11H15N |
Canonical SMILES: | CC1=CC=CC=C1C2(CC2)CN |
InChI: | InChI=1S/C11H15N/c1-9-4-2-3-5-10(9)11(8-12)6-7-11/h2-5H,6-8,12H2,1H3 |
InChI Key: | PSSGHGDRMZGMRG-UHFFFAOYSA-N |
LogP: | 2.68560 |
Publication Number | Title | Priority Date |
AU-2012331256-A1 | Pesticidal compounds | 20111104 |
BR-112014010133-B1 | pesticidal compound, a pharmaceutical composition comprising the pesticidal compound and treated plant propagating material | 20111104 |
CA-2853581-A1 | Pesticidal compounds | 20111104 |
CN-104024225-A | Pesticidal compounds | 20111104 |
EP-2773616-A1 | Pesticidal compounds | 20111104 |
Complexity: | 160 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 161.120449483 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 161.120449483 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS