1-(2-Methylphenyl)cyclopropanamine Hydrochloride - CAS 1134701-31-7
Catalog: |
BB003187 |
Product Name: |
1-(2-Methylphenyl)cyclopropanamine Hydrochloride |
CAS: |
1134701-31-7 |
Synonyms: |
1-(2-methylphenyl)-1-cyclopropanamine;hydrochloride; 1-(2-methylphenyl)cyclopropan-1-amine;hydrochloride |
IUPAC Name: | 1-(2-methylphenyl)cyclopropan-1-amine;hydrochloride |
Description: | 1-(2-Methylphenyl)cyclopropanamine Hydrochloride (CAS# 1134701-31-7) is a useful research chemical. |
Molecular Weight: | 183.68 |
Molecular Formula: | C10H14ClN |
Canonical SMILES: | CC1=CC=CC=C1C2(CC2)N.Cl |
InChI: | InChI=1S/C10H13N.ClH/c1-8-4-2-3-5-9(8)10(11)6-7-10;/h2-5H,6-7,11H2,1H3;1H |
InChI Key: | ZTCSPKKBVQLMRB-UHFFFAOYSA-N |
LogP: | 3.44510 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020131431-A1 | Chemical additives and surfactant combinations for favorable wettability alteration and improved hydrocarbon recovery factors | 20181026 |
WO-2020086309-A1 | Chemical additives and surfactant combinations for favorable wettability alteration and improved hydrocarbon recovery factors | 20181026 |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 183.0814771 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 183.0814771 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS