1-(2-Methylphenyl)cyclobutanecarbonitrile - CAS 29786-39-8
Catalog: |
BB020317 |
Product Name: |
1-(2-Methylphenyl)cyclobutanecarbonitrile |
CAS: |
29786-39-8 |
Synonyms: |
1-(2-methylphenyl)-1-cyclobutanecarbonitrile; 1-(2-methylphenyl)cyclobutane-1-carbonitrile |
IUPAC Name: | 1-(2-methylphenyl)cyclobutane-1-carbonitrile |
Description: | 1-(2-Methylphenyl)cyclobutanecarbonitrile (CAS# 29786-39-8 ) is a useful research chemical. |
Molecular Weight: | 171.24 |
Molecular Formula: | C12H13N |
Canonical SMILES: | CC1=CC=CC=C1C2(CCC2)C#N |
InChI: | InChI=1S/C12H13N/c1-10-5-2-3-6-11(10)12(9-13)7-4-8-12/h2-3,5-6H,4,7-8H2,1H3 |
InChI Key: | JKJIAVWVTFWKPR-UHFFFAOYSA-N |
LogP: | 2.94028 |
Publication Number | Title | Priority Date |
CA-3001666-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
CN-108699048-A | As 6 inhibitor oxadiazoles amine derivatives compounds of histone deacetylase and include the pharmaceutical composition of the compound | 20151012 |
EP-3362445-A1 | Oxadiazole amine derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20151012 |
JP-2018530571-A | Oxadiazoleamine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
JP-6697074-B2 | Oxadiazole amine derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20151012 |
Complexity: | 231 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 171.104799419 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 171.104799419 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 23.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
-
[89908-23-6]C23H22N2O5
2-Propenoic acid, 2-(3',3'-dimethyl-6-nitrospiro[2H-1-benzopyran-2,2'-[2H]indol]-1'(3'H)-yl)ethyl ester
-
[1383427-98-2]C7H13ClN2O2
(S)-Hexahydropyrazino[2,1-c][1,4]oxazin-4(3H)-one hydrochloride
-
[1281984-38-0]C8H10N4O4
1-Cyclopentyl-3,5-dinitro-1H-pyrazole
-
[1170836-25-5]C8H11N3O2
1-Cyclopentyl-5-nitro-1H-pyrazole
-
[55877-31-1]C9H5NO
1-Benzofuran-3-carbonitrile
-
[865774-78-3]C16H21F2NO2
2-(6,8-difluoro-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-pentanoic acid methyl ester
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS