1,2-Indandione-2-oxime - CAS 15028-10-1
Catalog: |
BB010512 |
Product Name: |
1,2-Indandione-2-oxime |
CAS: |
15028-10-1 |
Synonyms: |
(2Z)-2-hydroxyimino-3H-inden-1-one |
IUPAC Name: | (2E)-2-hydroxyimino-3H-inden-1-one |
Description: | 1,2-Indandione-2-oxime (CAS# 15028-10-1) is a useful research chemical. |
Molecular Weight: | 161.16 |
Molecular Formula: | C9H7NO2 |
Canonical SMILES: | C1C2=CC=CC=C2C(=O)C1=NO |
InChI: | InChI=1S/C9H7NO2/c11-9-7-4-2-1-3-6(7)5-8(9)10-12/h1-4,12H,5H2/b10-8- |
InChI Key: | CWEXMSPEUDRDPH-NTMALXAHSA-N |
Boiling Point: | 345.9 ℃ at 760 mmHg |
Density: | 1.34 g/cm3 |
MDL: | MFCD00082993 |
LogP: | 1.25560 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3044221-B1 | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | 20130911 |
US-2016221953-A1 | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | 20130911 |
US-9611223-B2 | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | 20130911 |
EP-2822656-B1 | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | 20120307 |
US-2015099732-A1 | 3-aryl-5-substituted-isoquinolin-1-one compounds and their therapeutic use | 20120307 |
Complexity: | 235 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 1 |
Exact Mass: | 161.047678466 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 161.047678466 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 49.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[104517-96-6]
Ioversol related compound B
-
[6315-52-2]
Ethylene di(p-toluenesulfonate)
-
[3553-80-8]
Ethyl diethylcarbamate
-
[1184173-73-6]
MK-8353
-
[1009-43-4]
4-Trimethylsilylstyrene
INDUSTRY LEADERS TRUST OUR PRODUCTS