1-(2-Fluorophenyl)cyclobutanemethanamine - CAS 859164-47-9
Catalog: |
BB037768 |
Product Name: |
1-(2-Fluorophenyl)cyclobutanemethanamine |
CAS: |
859164-47-9 |
Synonyms: |
[1-(2-fluorophenyl)cyclobutyl]methanamine; [1-(2-fluorophenyl)cyclobutyl]methanamine |
IUPAC Name: | [1-(2-fluorophenyl)cyclobutyl]methanamine |
Description: | 1-(2-Fluorophenyl)cyclobutanemethanamine (CAS# 859164-47-9) is a useful research chemical. |
Molecular Weight: | 179.23 |
Molecular Formula: | C11H14FN |
Canonical SMILES: | C1CC(C1)(CN)C2=CC=CC=C2F |
InChI: | InChI=1S/C11H14FN/c12-10-5-2-1-4-9(10)11(8-13)6-3-7-11/h1-2,4-5H,3,6-8,13H2 |
InChI Key: | KVTXPSFPFBHYSH-UHFFFAOYSA-N |
LogP: | 2.90640 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2007088018-A1 | Cb1 antagonist compounds | 20031223 |
US-2008287504-A1 | Cb1 modulator compounds | 20031223 |
US-7276516-B2 | CB1 antagonist compounds | 20031223 |
US-7595339-B2 | CB1 modulator compounds | 20031223 |
Complexity: | 177 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.111027613 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.111027613 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS